About 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea
1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea (PubChem CID 112817898) has the molecular formula C19H24F2N2O
and a molecular weight of 334.41 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea.
Molecular Properties
| Compound Name | 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea |
| PubChem CID | 112817898 |
| Molecular Formula | C19H24F2N2O |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea |
| SMILES | CC(NC(=O)NC1C2CC3CC(C2)CC1C3)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H24F2N2O/c1-10(13-2-3-16(20)17(21)9-13)22-19(24)23-18-14-5-11-4-12(7-14)8-15(18)6-11/h2-3,9-12,14-15,18H,4-8H2,1H3,(H2,22,23,24) |
| InChIKey | HWHJVOUCSXFDCS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea?
The IUPAC name of 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea (CID 112817898) is 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea.
What is the SMILES notation for 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea?
The canonical SMILES for 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea is CC(NC(=O)NC1C2CC3CC(C2)CC1C3)c1ccc(F)c(F)c1.
What is the InChIKey of 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea?
The InChIKey is HWHJVOUCSXFDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N2O/c1-10(13-2-3-16(20)17(21)9-13)22-19(24)23-18-14-5-11-4-12(7-14)8-15(18)6-11/h2-3,9-12,14-15,18H,4-8H2,1H3,(H2,22,23,24).
What are the key properties of 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea?
1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea has a molecular weight of 334.41 g/mol, XLogP of 4.15, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea is sourced from PubChem (CID 112817898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).