C19H24F2N2O — CID 112817898
1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea (PubChem CID 112817898) has the molecular formula C19H24F2N2O and a molecular weight of 334.41 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea.
| Compound Name | 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 112817898 |
| Molecular Formula | C19H24F2N2O |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-(2-adamantyl)-3-[1-(3,4-difluorophenyl)ethyl]urea |
| SMILES | CC(NC(=O)NC1C2CC3CC(C2)CC1C3)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H24F2N2O/c1-10(13-2-3-16(20)17(21)9-13)22-19(24)23-18-14-5-11-4-12(7-14)8-15(18)6-11/h2-3,9-12,14-15,18H,4-8H2,1H3,(H2,22,23,24) |
| InChIKey | HWHJVOUCSXFDCS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |