C23H30F2N2O2 — CID 66555578
N-(2-adamantyl)-4-[1-(3,4-difluorophenyl)ethyl]morpholine-2-carboxamide (PubChem CID 66555578) has the molecular formula C23H30F2N2O2 and a molecular weight of 404.50 g/mol. Its IUPAC name is N-(2-adamantyl)-4-[1-(3,4-difluorophenyl)ethyl]morpholine-2-carboxamide.
| Compound Name | N-(2-adamantyl)-4-[1-(3,4-difluorophenyl)ethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 66555578 |
| Molecular Formula | C23H30F2N2O2 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-(2-adamantyl)-4-[1-(3,4-difluorophenyl)ethyl]morpholine-2-carboxamide |
| SMILES | CC(c1ccc(F)c(F)c1)N1CCOC(C(=O)NC2C3CC4CC(C3)CC2C4)C1 |
| InChI | InChI=1S/C23H30F2N2O2/c1-13(16-2-3-19(24)20(25)11-16)27-4-5-29-21(12-27)23(28)26-22-17-7-14-6-15(9-17)10-18(22)8-14/h2-3,11,13-15,17-18,21-22H,4-10,12H2,1H3,(H,26,28) |
| InChIKey | XIGPVAOXEDABFM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |