C16H13ClF2N2O2S2 — CID 112832338
5-chloro-2-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-1-methylbenzimidazole (PubChem CID 112832338) has the molecular formula C16H13ClF2N2O2S2 and a molecular weight of 402.88 g/mol. Its IUPAC name is 5-chloro-2-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-1-methylbenzimidazole.
| Compound Name | 5-chloro-2-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-1-methylbenzimidazole |
|---|---|
| PubChem CID | 112832338 |
| Molecular Formula | C16H13ClF2N2O2S2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 5-chloro-2-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-1-methylbenzimidazole |
| SMILES | Cn1c(SCc2ccc(S(=O)(=O)C(F)F)cc2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H13ClF2N2O2S2/c1-21-14-7-4-11(17)8-13(14)20-16(21)24-9-10-2-5-12(6-3-10)25(22,23)15(18)19/h2-8,15H,9H2,1H3 |
| InChIKey | QMEZIJWAFVVJRB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |