C11H10ClN3S — CID 129366732
(2S)-2-(5-chloro-1-methylbenzimidazol-2-yl)sulfanylpropanenitrile (PubChem CID 129366732) has the molecular formula C11H10ClN3S and a molecular weight of 251.74 g/mol. Its IUPAC name is (2S)-2-(5-chloro-1-methylbenzimidazol-2-yl)sulfanylpropanenitrile.
| Compound Name | (2S)-2-(5-chloro-1-methylbenzimidazol-2-yl)sulfanylpropanenitrile |
|---|---|
| PubChem CID | 129366732 |
| Molecular Formula | C11H10ClN3S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | (2S)-2-(5-chloro-1-methylbenzimidazol-2-yl)sulfanylpropanenitrile |
| SMILES | C[C@@H](C#N)Sc1nc2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C11H10ClN3S/c1-7(6-13)16-11-14-9-5-8(12)3-4-10(9)15(11)2/h3-5,7H,1-2H3/t7-/m0/s1 |
| InChIKey | HETMZRFKTWNJNK-ZETCQYMHSA-N |
| XLogP | 3.23 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |