C32H27N3O2 — CID 112834104
N-[4-methyl-3-[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]phenyl]benzamide (PubChem CID 112834104) has the molecular formula C32H27N3O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[4-methyl-3-[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[4-methyl-3-[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 112834104 |
| Molecular Formula | C32H27N3O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[4-methyl-3-[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2)cc1NC(=O)Cc1c(C)nc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C32H27N3O2/c1-21-17-18-25(34-32(37)24-13-7-4-8-14-24)19-29(21)35-30(36)20-27-22(2)33-28-16-10-9-15-26(28)31(27)23-11-5-3-6-12-23/h3-19H,20H2,1-2H3,(H,34,37)(H,35,36) |
| InChIKey | VZSZBNJCHVPVRR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |