C22H22F2N2O4 — CID 112836324
4-[2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-2-oxoethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 112836324) has the molecular formula C22H22F2N2O4 and a molecular weight of 416.42 g/mol. Its IUPAC name is 4-[2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-2-oxoethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-2-oxoethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 112836324 |
| Molecular Formula | C22H22F2N2O4 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-2-oxoethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)N1CCC(Oc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C22H22F2N2O4/c23-14-3-4-17(16(24)10-14)30-15-5-7-25(8-6-15)18(27)11-26-21(28)19-12-1-2-13(9-12)20(19)22(26)29/h1-4,10,12-13,15,19-20H,5-9,11H2 |
| InChIKey | LSQSKIXKXBLJCA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|