C23H15BrClN3OS2 — CID 11283946
(5E)-5-[(4-bromophenyl)methylidene]-2-[5-(4-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one (PubChem CID 11283946) has the molecular formula C23H15BrClN3OS2 and a molecular weight of 528.88 g/mol. Its IUPAC name is (5E)-5-[(4-bromophenyl)methylidene]-2-[5-(4-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[(4-bromophenyl)methylidene]-2-[5-(4-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11283946 |
| Molecular Formula | C23H15BrClN3OS2 |
| Molecular Weight | 528.88 g/mol |
| Exact Mass | 526.95 |
| IUPAC Name | (5E)-5-[(4-bromophenyl)methylidene]-2-[5-(4-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2N=C(c3ccc(Cl)cc3)CC2c2cccs2)S/C1=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H15BrClN3OS2/c24-16-7-3-14(4-8-16)12-21-22(29)26-23(31-21)28-19(20-2-1-11-30-20)13-18(27-28)15-5-9-17(25)10-6-15/h1-12,19H,13H2/b21-12+ |
| InChIKey | TWNNKEZXOPTUKV-CIAFOILYSA-N |
| XLogP | 6.99 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.88 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|