C25H33FN4O — CID 112839499
2-(azepan-1-yl)-N-[4-[(2-fluoro-6-pyrrolidin-1-ylphenyl)methylamino]phenyl]acetamide (PubChem CID 112839499) has the molecular formula C25H33FN4O and a molecular weight of 424.56 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-[4-[(2-fluoro-6-pyrrolidin-1-ylphenyl)methylamino]phenyl]acetamide.
| Compound Name | 2-(azepan-1-yl)-N-[4-[(2-fluoro-6-pyrrolidin-1-ylphenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 112839499 |
| Molecular Formula | C25H33FN4O |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-(azepan-1-yl)-N-[4-[(2-fluoro-6-pyrrolidin-1-ylphenyl)methylamino]phenyl]acetamide |
| SMILES | O=C(CN1CCCCCC1)Nc1ccc(NCc2c(F)cccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C25H33FN4O/c26-23-8-7-9-24(30-16-5-6-17-30)22(23)18-27-20-10-12-21(13-11-20)28-25(31)19-29-14-3-1-2-4-15-29/h7-13,27H,1-6,14-19H2,(H,28,31) |
| InChIKey | CAZJTMWJBHIQRA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |