C23H28F2N4O3S — CID 16576216
2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 16576216) has the molecular formula C23H28F2N4O3S and a molecular weight of 478.57 g/mol. Its IUPAC name is 2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 16576216 |
| Molecular Formula | C23H28F2N4O3S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CN2CCN(S(=O)(=O)c3c(F)cccc3F)CC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C23H28F2N4O3S/c1-17-15-18(7-8-21(17)28-9-2-3-10-28)26-22(30)16-27-11-13-29(14-12-27)33(31,32)23-19(24)5-4-6-20(23)25/h4-8,15H,2-3,9-14,16H2,1H3,(H,26,30) |
| InChIKey | XXOPLSWYCPLCAD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|