C25H30N4O3S — CID 112840794
N-butyl-4-[[[5-[ethyl(phenyl)sulfamoyl]-2-pyridinyl]amino]methyl]benzamide (PubChem CID 112840794) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is N-butyl-4-[[[5-[ethyl(phenyl)sulfamoyl]-2-pyridinyl]amino]methyl]benzamide.
| Compound Name | N-butyl-4-[[[5-[ethyl(phenyl)sulfamoyl]-2-pyridinyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 112840794 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-butyl-4-[[[5-[ethyl(phenyl)sulfamoyl]-2-pyridinyl]amino]methyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(CNc2ccc(S(=O)(=O)N(CC)c3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C25H30N4O3S/c1-3-5-17-26-25(30)21-13-11-20(12-14-21)18-27-24-16-15-23(19-28-24)33(31,32)29(4-2)22-9-7-6-8-10-22/h6-16,19H,3-5,17-18H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | BHJYRFBATWUIEC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|