C22H25N3O3S — CID 55828070
6-[(3-ethoxyphenyl)methylamino]-N-ethyl-N-phenylpyridine-3-sulfonamide (PubChem CID 55828070) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 6-[(3-ethoxyphenyl)methylamino]-N-ethyl-N-phenylpyridine-3-sulfonamide.
| Compound Name | 6-[(3-ethoxyphenyl)methylamino]-N-ethyl-N-phenylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55828070 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 6-[(3-ethoxyphenyl)methylamino]-N-ethyl-N-phenylpyridine-3-sulfonamide |
| SMILES | CCOc1cccc(CNc2ccc(S(=O)(=O)N(CC)c3ccccc3)cn2)c1 |
| InChI | InChI=1S/C22H25N3O3S/c1-3-25(19-10-6-5-7-11-19)29(26,27)21-13-14-22(24-17-21)23-16-18-9-8-12-20(15-18)28-4-2/h5-15,17H,3-4,16H2,1-2H3,(H,23,24) |
| InChIKey | VENXTUQUPHVWSB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |