C26H30N4O3S — CID 112798825
N-ethyl-N-phenyl-6-[[4-(piperidine-1-carbonyl)phenyl]methylamino]pyridine-3-sulfonamide (PubChem CID 112798825) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is N-ethyl-N-phenyl-6-[[4-(piperidine-1-carbonyl)phenyl]methylamino]pyridine-3-sulfonamide.
| Compound Name | N-ethyl-N-phenyl-6-[[4-(piperidine-1-carbonyl)phenyl]methylamino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 112798825 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-ethyl-N-phenyl-6-[[4-(piperidine-1-carbonyl)phenyl]methylamino]pyridine-3-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(NCc2ccc(C(=O)N3CCCCC3)cc2)nc1 |
| InChI | InChI=1S/C26H30N4O3S/c1-2-30(23-9-5-3-6-10-23)34(32,33)24-15-16-25(28-20-24)27-19-21-11-13-22(14-12-21)26(31)29-17-7-4-8-18-29/h3,5-6,9-16,20H,2,4,7-8,17-19H2,1H3,(H,27,28) |
| InChIKey | XDTITFGOQSFDDF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |