C18H16Cl3NO4 — CID 112843659
2,3,5-trichloro-6-hydroxy-N-[4-(oxolan-2-ylmethoxy)phenyl]benzamide (PubChem CID 112843659) has the molecular formula C18H16Cl3NO4 and a molecular weight of 416.69 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-[4-(oxolan-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-[4-(oxolan-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 112843659 |
| Molecular Formula | C18H16Cl3NO4 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-[4-(oxolan-2-ylmethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC2CCCO2)cc1)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C18H16Cl3NO4/c19-13-8-14(20)17(23)15(16(13)21)18(24)22-10-3-5-11(6-4-10)26-9-12-2-1-7-25-12/h3-6,8,12,23H,1-2,7,9H2,(H,22,24) |
| InChIKey | MTOMYNIJDSSTAX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|