C18H17F2NO4 — CID 71883389
2,4-difluoro-6-hydroxy-N-[4-(oxolan-2-ylmethoxy)phenyl]benzamide (PubChem CID 71883389) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is 2,4-difluoro-6-hydroxy-N-[4-(oxolan-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 2,4-difluoro-6-hydroxy-N-[4-(oxolan-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 71883389 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2,4-difluoro-6-hydroxy-N-[4-(oxolan-2-ylmethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC2CCCO2)cc1)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C18H17F2NO4/c19-11-8-15(20)17(16(22)9-11)18(23)21-12-3-5-13(6-4-12)25-10-14-2-1-7-24-14/h3-6,8-9,14,22H,1-2,7,10H2,(H,21,23) |
| InChIKey | KQXBYQHADFOXMD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |