C18H20ClNO3 — CID 112844479
N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-(2-methylphenoxy)ethanamine (PubChem CID 112844479) has the molecular formula C18H20ClNO3 and a molecular weight of 333.81 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-(2-methylphenoxy)ethanamine.
| Compound Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-(2-methylphenoxy)ethanamine |
|---|---|
| PubChem CID | 112844479 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-(2-methylphenoxy)ethanamine |
| SMILES | Cc1ccccc1OCCNCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C18H20ClNO3/c1-13-4-2-3-5-16(13)21-7-6-20-12-14-10-15(19)18-17(11-14)22-8-9-23-18/h2-5,10-11,20H,6-9,12H2,1H3 |
| InChIKey | SFFQZQVEJSOHQR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|