C25H25N3O3S — CID 112845098
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-1-butanoylpyrrolidine-2-carboxamide (PubChem CID 112845098) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-1-butanoylpyrrolidine-2-carboxamide.
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-1-butanoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 112845098 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-1-butanoylpyrrolidine-2-carboxamide |
| SMILES | CCCC(=O)N1CCCC1C(=O)Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C25H25N3O3S/c1-2-10-20(29)28-16-9-15-19(28)24(31)27-25-26-21(17-11-5-3-6-12-17)23(32-25)22(30)18-13-7-4-8-14-18/h3-8,11-14,19H,2,9-10,15-16H2,1H3,(H,26,27,31) |
| InChIKey | YOOWFUIZJYCMBS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |