C15H17ClN4O2S — CID 124740351
(2S)-1-butanoyl-N-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)pyrrolidine-2-carboxamide (PubChem CID 124740351) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is (2S)-1-butanoyl-N-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-butanoyl-N-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 124740351 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (2S)-1-butanoyl-N-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CCCC(=O)N1CCC[C@H]1C(=O)Nc1nc2ccc(Cl)nc2s1 |
| InChI | InChI=1S/C15H17ClN4O2S/c1-2-4-12(21)20-8-3-5-10(20)13(22)19-15-17-9-6-7-11(16)18-14(9)23-15/h6-7,10H,2-5,8H2,1H3,(H,17,19,22)/t10-/m0/s1 |
| InChIKey | UQXCZWRIMYNKPK-JTQLQIEISA-N |
| XLogP | 3.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|