C19H22ClN3O2 — CID 123233355
(2S)-N-(2-chloroquinolin-6-yl)-1-(3-methylbutanoyl)pyrrolidine-2-carboxamide (PubChem CID 123233355) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is (2S)-N-(2-chloroquinolin-6-yl)-1-(3-methylbutanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(2-chloroquinolin-6-yl)-1-(3-methylbutanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123233355 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (2S)-N-(2-chloroquinolin-6-yl)-1-(3-methylbutanoyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)CC(=O)N1CCC[C@H]1C(=O)Nc1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-12(2)10-18(24)23-9-3-4-16(23)19(25)21-14-6-7-15-13(11-14)5-8-17(20)22-15/h5-8,11-12,16H,3-4,9-10H2,1-2H3,(H,21,25)/t16-/m0/s1 |
| InChIKey | HBVFSQQIFAGJLS-INIZCTEOSA-N |
| XLogP | 3.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|