C25H23N3O6S — CID 89108183
methyl 4-(4-formylphenyl)-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 89108183) has the molecular formula C25H23N3O6S and a molecular weight of 493.54 g/mol. Its IUPAC name is methyl 4-(4-formylphenyl)-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-(4-formylphenyl)-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 89108183 |
| Molecular Formula | C25H23N3O6S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | methyl 4-(4-formylphenyl)-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)[C@@H]2CCCN2C(=O)OCc2ccccc2)nc1-c1ccc(C=O)cc1 |
| InChI | InChI=1S/C25H23N3O6S/c1-33-23(31)21-20(18-11-9-16(14-29)10-12-18)26-24(35-21)27-22(30)19-8-5-13-28(19)25(32)34-15-17-6-3-2-4-7-17/h2-4,6-7,9-12,14,19H,5,8,13,15H2,1H3,(H,26,27,30)/t19-/m0/s1 |
| InChIKey | VYYFVJMKRLPFMX-IBGZPJMESA-N |
| XLogP | 4.15 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|