C34H14F10N2 — CID 11285131
1-(2,3,4,5,6-pentafluorophenyl)-N-[1-[2-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]naphthalen-1-yl]naphthalen-2-yl]methanimine (PubChem CID 11285131) has the molecular formula C34H14F10N2 and a molecular weight of 640.48 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-N-[1-[2-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]naphthalen-1-yl]naphthalen-2-yl]methanimine.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-N-[1-[2-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]naphthalen-1-yl]naphthalen-2-yl]methanimine |
|---|---|
| PubChem CID | 11285131 |
| Molecular Formula | C34H14F10N2 |
| Molecular Weight | 640.48 g/mol |
| Exact Mass | 640.10 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-N-[1-[2-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]naphthalen-1-yl]naphthalen-2-yl]methanimine |
| SMILES | Fc1c(F)c(F)c(/C=N/c2ccc3ccccc3c2-c2c(/N=C/c3c(F)c(F)c(F)c(F)c3F)ccc3ccccc23)c(F)c1F |
| InChI | InChI=1S/C34H14F10N2/c35-25-19(26(36)30(40)33(43)29(25)39)13-45-21-11-9-15-5-1-3-7-17(15)23(21)24-18-8-4-2-6-16(18)10-12-22(24)46-14-20-27(37)31(41)34(44)32(42)28(20)38/h1-14H/b45-13+,46-14+ |
| InChIKey | OZPDXSPDFHREPM-JAMPESMLSA-N |
| XLogP | 10.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.48 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|