C13H4F7N — CID 23278103
N-(2,4-difluorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)methanimine (PubChem CID 23278103) has the molecular formula C13H4F7N and a molecular weight of 307.17 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)methanimine.
| Compound Name | N-(2,4-difluorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
|---|---|
| PubChem CID | 23278103 |
| Molecular Formula | C13H4F7N |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
| SMILES | Fc1ccc(/N=C/c2c(F)c(F)c(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C13H4F7N/c14-5-1-2-8(7(15)3-5)21-4-6-9(16)11(18)13(20)12(19)10(6)17/h1-4H/b21-4+ |
| InChIKey | DRRZARPNSVKDET-IPBDZQFASA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|