C13H7F4N — CID 139199985
N-(2,5-difluorophenyl)-1-(3,5-difluorophenyl)methanimine (PubChem CID 139199985) has the molecular formula C13H7F4N and a molecular weight of 253.20 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-1-(3,5-difluorophenyl)methanimine.
| Compound Name | N-(2,5-difluorophenyl)-1-(3,5-difluorophenyl)methanimine |
|---|---|
| PubChem CID | 139199985 |
| Molecular Formula | C13H7F4N |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | N-(2,5-difluorophenyl)-1-(3,5-difluorophenyl)methanimine |
| SMILES | Fc1cc(F)cc(/C=N/c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C13H7F4N/c14-9-1-2-12(17)13(6-9)18-7-8-3-10(15)5-11(16)4-8/h1-7H/b18-7+ |
| InChIKey | ICUQROULQQDFHA-CNHKJKLMSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|