C21H22N4O4 — CID 112863695
4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-4,6-diamine (PubChem CID 112863695) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112863695 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-N-[2-(4-methoxyphenoxy)ethyl]pyrimidine-4,6-diamine |
| SMILES | COc1ccc(OCCNc2cc(Nc3ccc4c(c3)OCCO4)ncn2)cc1 |
| InChI | InChI=1S/C21H22N4O4/c1-26-16-3-5-17(6-4-16)27-9-8-22-20-13-21(24-14-23-20)25-15-2-7-18-19(12-15)29-11-10-28-18/h2-7,12-14H,8-11H2,1H3,(H2,22,23,24,25) |
| InChIKey | NQCPZPDDVWYKFW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|