C20H28N4 — CID 112869239
2-methyl-6-(4-methylpiperidin-1-yl)-N-(4-propan-2-ylphenyl)pyrimidin-4-amine (PubChem CID 112869239) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-methyl-6-(4-methylpiperidin-1-yl)-N-(4-propan-2-ylphenyl)pyrimidin-4-amine.
| Compound Name | 2-methyl-6-(4-methylpiperidin-1-yl)-N-(4-propan-2-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112869239 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-methyl-6-(4-methylpiperidin-1-yl)-N-(4-propan-2-ylphenyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccc(C(C)C)cc2)cc(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C20H28N4/c1-14(2)17-5-7-18(8-6-17)23-19-13-20(22-16(4)21-19)24-11-9-15(3)10-12-24/h5-8,13-15H,9-12H2,1-4H3,(H,21,22,23) |
| InChIKey | LZFCCMRXYPUEAP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |