C17H22N4O2S — CID 154780681
2-methyl-6-(4-methylsulfonylpiperidin-1-yl)-N-phenylpyrimidin-4-amine (PubChem CID 154780681) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-methyl-6-(4-methylsulfonylpiperidin-1-yl)-N-phenylpyrimidin-4-amine.
| Compound Name | 2-methyl-6-(4-methylsulfonylpiperidin-1-yl)-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 154780681 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-methyl-6-(4-methylsulfonylpiperidin-1-yl)-N-phenylpyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccccc2)cc(N2CCC(S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C17H22N4O2S/c1-13-18-16(20-14-6-4-3-5-7-14)12-17(19-13)21-10-8-15(9-11-21)24(2,22)23/h3-7,12,15H,8-11H2,1-2H3,(H,18,19,20) |
| InChIKey | IRMCAJLXFIZOSL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |