C16H21N5O2S — CID 170533665
6-(4-aminopiperidin-1-yl)-2-methylsulfonyl-N-phenylpyrimidin-4-amine (PubChem CID 170533665) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 6-(4-aminopiperidin-1-yl)-2-methylsulfonyl-N-phenylpyrimidin-4-amine.
| Compound Name | 6-(4-aminopiperidin-1-yl)-2-methylsulfonyl-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 170533665 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 6-(4-aminopiperidin-1-yl)-2-methylsulfonyl-N-phenylpyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1nc(Nc2ccccc2)cc(N2CCC(N)CC2)n1 |
| InChI | InChI=1S/C16H21N5O2S/c1-24(22,23)16-19-14(18-13-5-3-2-4-6-13)11-15(20-16)21-9-7-12(17)8-10-21/h2-6,11-12H,7-10,17H2,1H3,(H,18,19,20) |
| InChIKey | SVHXSGRQWUDFMS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |