C20H27N5O4S — CID 170442084
tert-butyl 4-(6-anilino-2-methylsulfonylpyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 170442084) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is tert-butyl 4-(6-anilino-2-methylsulfonylpyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-anilino-2-methylsulfonylpyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170442084 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | tert-butyl 4-(6-anilino-2-methylsulfonylpyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(Nc3ccccc3)nc(S(C)(=O)=O)n2)CC1 |
| InChI | InChI=1S/C20H27N5O4S/c1-20(2,3)29-19(26)25-12-10-24(11-13-25)17-14-16(21-15-8-6-5-7-9-15)22-18(23-17)30(4,27)28/h5-9,14H,10-13H2,1-4H3,(H,21,22,23) |
| InChIKey | YLZIVUGTZIGWNC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |