About 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine
4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine (PubChem CID 112884418) has the molecular formula C22H23ClN4O
and a molecular weight of 394.91 g/mol. Its IUPAC name is 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine |
| PubChem CID | 112884418 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine |
| SMILES | Clc1ccc(COc2ccc(Nc3ccnc(NC4CCCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C22H23ClN4O/c23-17-7-5-16(6-8-17)15-28-20-11-9-19(10-12-20)25-21-13-14-24-22(27-21)26-18-3-1-2-4-18/h5-14,18H,1-4,15H2,(H2,24,25,26,27) |
| InChIKey | WFOFUQSIPCKASB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine?
The IUPAC name of 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine (CID 112884418) is 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine.
What is the SMILES notation for 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine?
The canonical SMILES for 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine is Clc1ccc(COc2ccc(Nc3ccnc(NC4CCCC4)n3)cc2)cc1.
What is the InChIKey of 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine?
The InChIKey is WFOFUQSIPCKASB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClN4O/c23-17-7-5-16(6-8-17)15-28-20-11-9-19(10-12-20)25-21-13-14-24-22(27-21)26-18-3-1-2-4-18/h5-14,18H,1-4,15H2,(H2,24,25,26,27).
What are the key properties of 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine?
4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine has a molecular weight of 394.91 g/mol, XLogP of 5.81, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[4-[(4-chlorophenyl)methoxy]phenyl]-2-N-cyclopentylpyrimidine-2,4-diamine is sourced from PubChem (CID 112884418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).