C19H19BrN4 — CID 112899325
2-N-(3-bromophenyl)-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine (PubChem CID 112899325) has the molecular formula C19H19BrN4 and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-bromophenyl)-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112899325 |
| Molecular Formula | C19H19BrN4 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-N-(3-bromophenyl)-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
| SMILES | Brc1cccc(Nc2nccc(NCCCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H19BrN4/c20-16-9-4-10-17(14-16)23-19-22-13-11-18(24-19)21-12-5-8-15-6-2-1-3-7-15/h1-4,6-7,9-11,13-14H,5,8,12H2,(H2,21,22,23,24) |
| InChIKey | JJLNTXNLWQZXQY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|