C20H19F3N4 — CID 112899308
4-N-(3-phenylpropyl)-2-N-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 112899308) has the molecular formula C20H19F3N4 and a molecular weight of 372.39 g/mol. Its IUPAC name is 4-N-(3-phenylpropyl)-2-N-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-phenylpropyl)-2-N-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112899308 |
| Molecular Formula | C20H19F3N4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-N-(3-phenylpropyl)-2-N-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | FC(F)(F)c1cccc(Nc2nccc(NCCCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H19F3N4/c21-20(22,23)16-9-4-10-17(14-16)26-19-25-13-11-18(27-19)24-12-5-8-15-6-2-1-3-7-15/h1-4,6-7,9-11,13-14H,5,8,12H2,(H2,24,25,26,27) |
| InChIKey | NUFHMHAPXJLFOT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|