C14H26N2O6 — CID 11290113
(3S,4S)-N-tert-butyl-3,4-dihydroxy-1-[2-(2-methoxyethoxy)acetyl]pyrrolidine-2-carboxamide (PubChem CID 11290113) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3S,4S)-N-tert-butyl-3,4-dihydroxy-1-[2-(2-methoxyethoxy)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (3S,4S)-N-tert-butyl-3,4-dihydroxy-1-[2-(2-methoxyethoxy)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11290113 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3S,4S)-N-tert-butyl-3,4-dihydroxy-1-[2-(2-methoxyethoxy)acetyl]pyrrolidine-2-carboxamide |
| SMILES | COCCOCC(=O)N1C[C@H](O)[C@@H](O)C1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H26N2O6/c1-14(2,3)15-13(20)11-12(19)9(17)7-16(11)10(18)8-22-6-5-21-4/h9,11-12,17,19H,5-8H2,1-4H3,(H,15,20)/t9-,11?,12+/m0/s1 |
| InChIKey | UWWNSOIXKLWJLG-VSJGMXPKSA-N |
| XLogP | -1.50 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|