C16H21NO7 — CID 11290718
ethyl 2-[(2-ethoxy-2-oxoethyl)-[(5-formyl-2,3-dihydroxyphenyl)methyl]amino]acetate (PubChem CID 11290718) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is ethyl 2-[(2-ethoxy-2-oxoethyl)-[(5-formyl-2,3-dihydroxyphenyl)methyl]amino]acetate.
| Compound Name | ethyl 2-[(2-ethoxy-2-oxoethyl)-[(5-formyl-2,3-dihydroxyphenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 11290718 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethyl 2-[(2-ethoxy-2-oxoethyl)-[(5-formyl-2,3-dihydroxyphenyl)methyl]amino]acetate |
| SMILES | CCOC(=O)CN(CC(=O)OCC)Cc1cc(C=O)cc(O)c1O |
| InChI | InChI=1S/C16H21NO7/c1-3-23-14(20)8-17(9-15(21)24-4-2)7-12-5-11(10-18)6-13(19)16(12)22/h5-6,10,19,22H,3-4,7-9H2,1-2H3 |
| InChIKey | HAPWLCXUJALVIK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|