C19H24N4O2 — CID 112907954
4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-methyl-N-prop-2-enylpyrimidin-2-amine (PubChem CID 112907954) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-methyl-N-prop-2-enylpyrimidin-2-amine.
| Compound Name | 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-methyl-N-prop-2-enylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112907954 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-6-methyl-N-prop-2-enylpyrimidin-2-amine |
| SMILES | C=CCNc1nc(C)cc(N2CCc3cc(OC)c(OC)cc3C2)n1 |
| InChI | InChI=1S/C19H24N4O2/c1-5-7-20-19-21-13(2)9-18(22-19)23-8-6-14-10-16(24-3)17(25-4)11-15(14)12-23/h5,9-11H,1,6-8,12H2,2-4H3,(H,20,21,22) |
| InChIKey | ZRSIVUJGZHWJAK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|