About 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine
4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine (PubChem CID 112907944) has the molecular formula C20H27N5
and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine |
| PubChem CID | 112907944 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine |
| SMILES | C=CCNc1nc(C)cc(N2CCN(c3cccc(C)c3C)CC2)n1 |
| InChI | InChI=1S/C20H27N5/c1-5-9-21-20-22-16(3)14-19(23-20)25-12-10-24(11-13-25)18-8-6-7-15(2)17(18)4/h5-8,14H,1,9-13H2,2-4H3,(H,21,22,23) |
| InChIKey | PACGQZLAPVRBNG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine?
The IUPAC name of 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine (CID 112907944) is 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine.
What is the SMILES notation for 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine?
The canonical SMILES for 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine is C=CCNc1nc(C)cc(N2CCN(c3cccc(C)c3C)CC2)n1.
What is the InChIKey of 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine?
The InChIKey is PACGQZLAPVRBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N5/c1-5-9-21-20-22-16(3)14-19(23-20)25-12-10-24(11-13-25)18-8-6-7-15(2)17(18)4/h5-8,14H,1,9-13H2,2-4H3,(H,21,22,23).
What are the key properties of 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine?
4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine has a molecular weight of 337.47 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine is sourced from PubChem (CID 112907944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).