C20H27N5 — CID 112907944
4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine (PubChem CID 112907944) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine.
| Compound Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112907944 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methyl-N-prop-2-enylpyrimidin-2-amine |
| SMILES | C=CCNc1nc(C)cc(N2CCN(c3cccc(C)c3C)CC2)n1 |
| InChI | InChI=1S/C20H27N5/c1-5-9-21-20-22-16(3)14-19(23-20)25-12-10-24(11-13-25)18-8-6-7-15(2)17(18)4/h5-8,14H,1,9-13H2,2-4H3,(H,21,22,23) |
| InChIKey | PACGQZLAPVRBNG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|