C21H22N4 — CID 112908038
4-N-benzyl-6-methyl-4-N-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112908038) has the molecular formula C21H22N4 and a molecular weight of 330.44 g/mol. Its IUPAC name is 4-N-benzyl-6-methyl-4-N-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-6-methyl-4-N-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112908038 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-N-benzyl-6-methyl-4-N-phenyl-2-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1nc(C)cc(N(Cc2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C21H22N4/c1-3-14-22-21-23-17(2)15-20(24-21)25(19-12-8-5-9-13-19)16-18-10-6-4-7-11-18/h3-13,15H,1,14,16H2,2H3,(H,22,23,24) |
| InChIKey | DZKVNDIPMZFMKR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|