C16H17IN2 — CID 11291351
(Z)-3-(4-iodophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine (PubChem CID 11291351) has the molecular formula C16H17IN2 and a molecular weight of 360.23 g/mol. Its IUPAC name is (Z)-3-(4-iodophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine.
| Compound Name | (Z)-3-(4-iodophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine |
|---|---|
| PubChem CID | 11291351 |
| Molecular Formula | C16H17IN2 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | (Z)-3-(4-iodophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine |
| SMILES | CN(C)C/C=C(/c1ccc([123I])cc1)c1cccnc1 |
| InChI | InChI=1S/C16H17IN2/c1-19(2)11-9-16(14-4-3-10-18-12-14)13-5-7-15(17)8-6-13/h3-10,12H,11H2,1-2H3/b16-9-/i17-4 |
| InChIKey | PEHSPOJQDWLUFV-AKTIBJBQSA-N |
| XLogP | 3.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|