C16H18BrN2O3P — CID 58600544
N-[(E)-3-(4-bromophenyl)-3-pyridin-3-ylprop-2-enyl]-methoxy-N-methylphosphonamidic acid (PubChem CID 58600544) has the molecular formula C16H18BrN2O3P and a molecular weight of 397.21 g/mol. Its IUPAC name is N-[(E)-3-(4-bromophenyl)-3-pyridin-3-ylprop-2-enyl]-methoxy-N-methylphosphonamidic acid.
| Compound Name | N-[(E)-3-(4-bromophenyl)-3-pyridin-3-ylprop-2-enyl]-methoxy-N-methylphosphonamidic acid |
|---|---|
| PubChem CID | 58600544 |
| Molecular Formula | C16H18BrN2O3P |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-[(E)-3-(4-bromophenyl)-3-pyridin-3-ylprop-2-enyl]-methoxy-N-methylphosphonamidic acid |
| SMILES | COP(=O)(O)N(C)C/C=C(\c1ccc(Br)cc1)c1cccnc1 |
| InChI | InChI=1S/C16H18BrN2O3P/c1-19(23(20,21)22-2)11-9-16(14-4-3-10-18-12-14)13-5-7-15(17)8-6-13/h3-10,12H,11H2,1-2H3,(H,20,21)/b16-9+ |
| InChIKey | TZOTXTMNEVCLEU-CXUHLZMHSA-N |
| XLogP | 3.95 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|