C21H17NO4 — CID 71325558
2-hydroxy-4-(3-phenyl-3-pyridin-3-ylprop-2-enoxy)benzoic acid (PubChem CID 71325558) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-hydroxy-4-(3-phenyl-3-pyridin-3-ylprop-2-enoxy)benzoic acid.
| Compound Name | 2-hydroxy-4-(3-phenyl-3-pyridin-3-ylprop-2-enoxy)benzoic acid |
|---|---|
| PubChem CID | 71325558 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-hydroxy-4-(3-phenyl-3-pyridin-3-ylprop-2-enoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(OCC=C(c2ccccc2)c2cccnc2)cc1O |
| InChI | InChI=1S/C21H17NO4/c23-20-13-17(8-9-19(20)21(24)25)26-12-10-18(15-5-2-1-3-6-15)16-7-4-11-22-14-16/h1-11,13-14,23H,12H2,(H,24,25) |
| InChIKey | WGCCWPQQQSXVTO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |