C20H20F2N4 — CID 112924398
2-N-(3,4-difluorophenyl)-6-methyl-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine (PubChem CID 112924398) has the molecular formula C20H20F2N4 and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-N-(3,4-difluorophenyl)-6-methyl-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,4-difluorophenyl)-6-methyl-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112924398 |
| Molecular Formula | C20H20F2N4 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-N-(3,4-difluorophenyl)-6-methyl-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NCCCc2ccccc2)nc(Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C20H20F2N4/c1-14-12-19(23-11-5-8-15-6-3-2-4-7-15)26-20(24-14)25-16-9-10-17(21)18(22)13-16/h2-4,6-7,9-10,12-13H,5,8,11H2,1H3,(H2,23,24,25,26) |
| InChIKey | GLQVEUPRDGPDBA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|