C14H16F3N5O — CID 112943975
3-N-(3-methoxypropyl)-5-N-[4-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112943975) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is 3-N-(3-methoxypropyl)-5-N-[4-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(3-methoxypropyl)-5-N-[4-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943975 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-N-(3-methoxypropyl)-5-N-[4-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COCCCNc1nncc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C14H16F3N5O/c1-23-8-2-7-18-13-21-12(9-19-22-13)20-11-5-3-10(4-6-11)14(15,16)17/h3-6,9H,2,7-8H2,1H3,(H2,18,20,21,22) |
| InChIKey | IBUJBMKYPANPTF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|