C14H23N5O — CID 112944417
3-(azepan-1-yl)-N-(oxolan-2-ylmethyl)-1,2,4-triazin-5-amine (PubChem CID 112944417) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-(azepan-1-yl)-N-(oxolan-2-ylmethyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(azepan-1-yl)-N-(oxolan-2-ylmethyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112944417 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 3-(azepan-1-yl)-N-(oxolan-2-ylmethyl)-1,2,4-triazin-5-amine |
| SMILES | c1nnc(N2CCCCCC2)nc1NCC1CCCO1 |
| InChI | InChI=1S/C14H23N5O/c1-2-4-8-19(7-3-1)14-17-13(11-16-18-14)15-10-12-6-5-9-20-12/h11-12H,1-10H2,(H,15,17,18) |
| InChIKey | VCIJIWBPZBWFJU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |