C20H20F3NO5S2 — CID 11294471
[6,7-dimethyl-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 11294471) has the molecular formula C20H20F3NO5S2 and a molecular weight of 475.51 g/mol. Its IUPAC name is [6,7-dimethyl-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [6,7-dimethyl-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11294471 |
| Molecular Formula | C20H20F3NO5S2 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | [6,7-dimethyl-4-[(4-methylphenyl)sulfonylamino]-5,8-dihydronaphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | CC1=C(C)Cc2c(OS(=O)(=O)C(F)(F)F)ccc(NS(=O)(=O)c3ccc(C)cc3)c2C1 |
| InChI | InChI=1S/C20H20F3NO5S2/c1-12-4-6-15(7-5-12)30(25,26)24-18-8-9-19(29-31(27,28)20(21,22)23)17-11-14(3)13(2)10-16(17)18/h4-9,24H,10-11H2,1-3H3 |
| InChIKey | REDGTLYRCCEVJS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|