C25H26N2O6S — CID 11294623
(1S,2R,3R,4R)-4-acetyl-1-methyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-nitrocyclohexane-1-carbaldehyde (PubChem CID 11294623) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is (1S,2R,3R,4R)-4-acetyl-1-methyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-nitrocyclohexane-1-carbaldehyde.
| Compound Name | (1S,2R,3R,4R)-4-acetyl-1-methyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-nitrocyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 11294623 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (1S,2R,3R,4R)-4-acetyl-1-methyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-nitrocyclohexane-1-carbaldehyde |
| SMILES | CC(=O)[C@@H]1CC[C@](C)(C=O)[C@H]([N+](=O)[O-])[C@H]1c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H26N2O6S/c1-16-8-10-18(11-9-16)34(32,33)26-14-21(20-6-4-5-7-22(20)26)23-19(17(2)29)12-13-25(3,15-28)24(23)27(30)31/h4-11,14-15,19,23-24H,12-13H2,1-3H3/t19-,23+,24+,25+/m0/s1 |
| InChIKey | VZKLTXZCJYGRLZ-ZPOKTZCFSA-N |
| XLogP | 4.12 |
| TPSA | 116.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|