C15H19FN6 — CID 112946446
3-(4-ethylpiperazin-1-yl)-N-(3-fluorophenyl)-1,2,4-triazin-5-amine (PubChem CID 112946446) has the molecular formula C15H19FN6 and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)-N-(3-fluorophenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(4-ethylpiperazin-1-yl)-N-(3-fluorophenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112946446 |
| Molecular Formula | C15H19FN6 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)-N-(3-fluorophenyl)-1,2,4-triazin-5-amine |
| SMILES | CCN1CCN(c2nncc(Nc3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C15H19FN6/c1-2-21-6-8-22(9-7-21)15-19-14(11-17-20-15)18-13-5-3-4-12(16)10-13/h3-5,10-11H,2,6-9H2,1H3,(H,18,19,20) |
| InChIKey | RLRPREAACUQKSM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |