C20H21N5O7S3 — CID 11295648
N-(4-methylsulfonylphenyl)-5-nitro-6-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyrimidin-4-amine (PubChem CID 11295648) has the molecular formula C20H21N5O7S3 and a molecular weight of 539.62 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-5-nitro-6-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyrimidin-4-amine.
| Compound Name | N-(4-methylsulfonylphenyl)-5-nitro-6-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 11295648 |
| Molecular Formula | C20H21N5O7S3 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-5-nitro-6-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncnc(OC3CCN(S(=O)(=O)c4cccs4)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21N5O7S3/c1-34(28,29)16-6-4-14(5-7-16)23-19-18(25(26)27)20(22-13-21-19)32-15-8-10-24(11-9-15)35(30,31)17-3-2-12-33-17/h2-7,12-13,15H,8-11H2,1H3,(H,21,22,23) |
| InChIKey | OGIWNXGYRVBJBD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 161.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|