C24H28Cl2N2O8 — CID 11295708
3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-5-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamoyl]benzoic acid (PubChem CID 11295708) has the molecular formula C24H28Cl2N2O8 and a molecular weight of 543.40 g/mol. Its IUPAC name is 3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-5-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamoyl]benzoic acid.
| Compound Name | 3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-5-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 11295708 |
| Molecular Formula | C24H28Cl2N2O8 |
| Molecular Weight | 543.40 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-5-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamoyl]benzoic acid |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2cc(C(=O)O)cc(C(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c2)C1 |
| InChI | InChI=1S/C24H28Cl2N2O8/c1-28-8-16(15-5-14(25)6-18(26)17(15)9-28)11-2-12(4-13(3-11)24(35)36)23(34)27-7-19(30)21(32)22(33)20(31)10-29/h2-6,16,19-22,29-33H,7-10H2,1H3,(H,27,34)(H,35,36)/t16?,19-,20+,21+,22+/m0/s1 |
| InChIKey | QDILTWVQJSRDCV-NFHXIFCJSA-N |
| XLogP | 0.43 |
| TPSA | 170.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |