C22H26Cl2N2O6 — CID 11329212
N-[2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 11329212) has the molecular formula C22H26Cl2N2O6 and a molecular weight of 485.36 g/mol. Its IUPAC name is N-[2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-[2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 11329212 |
| Molecular Formula | C22H26Cl2N2O6 |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | N-[2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccccc2NC(=O)C(O)C(O)C(O)C(O)CO)C1 |
| InChI | InChI=1S/C22H26Cl2N2O6/c1-26-8-14(13-6-11(23)7-16(24)15(13)9-26)12-4-2-3-5-17(12)25-22(32)21(31)20(30)19(29)18(28)10-27/h2-7,14,18-21,27-31H,8-10H2,1H3,(H,25,32) |
| InChIKey | FXRLATZOAILORS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |