C22H26Cl2N2O5 — CID 142944526
N-[2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-2,3,4,6-tetrahydroxyhexanamide (PubChem CID 142944526) has the molecular formula C22H26Cl2N2O5 and a molecular weight of 469.37 g/mol. Its IUPAC name is N-[2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-2,3,4,6-tetrahydroxyhexanamide.
| Compound Name | N-[2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-2,3,4,6-tetrahydroxyhexanamide |
|---|---|
| PubChem CID | 142944526 |
| Molecular Formula | C22H26Cl2N2O5 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | N-[2-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-2,3,4,6-tetrahydroxyhexanamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccccc2NC(=O)C(O)C(O)C(O)CCO)C1 |
| InChI | InChI=1S/C22H26Cl2N2O5/c1-26-10-15(14-8-12(23)9-17(24)16(14)11-26)13-4-2-3-5-18(13)25-22(31)21(30)20(29)19(28)6-7-27/h2-5,8-9,15,19-21,27-30H,6-7,10-11H2,1H3,(H,25,31) |
| InChIKey | VPNBGTMQTTZLFM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |