C20H23N5O — CID 112959095
3-N-tert-butyl-5-N-(4-phenylmethoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112959095) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-N-tert-butyl-5-N-(4-phenylmethoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-tert-butyl-5-N-(4-phenylmethoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112959095 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-N-tert-butyl-5-N-(4-phenylmethoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CC(C)(C)Nc1nncc(Nc2ccc(OCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C20H23N5O/c1-20(2,3)24-19-23-18(13-21-25-19)22-16-9-11-17(12-10-16)26-14-15-7-5-4-6-8-15/h4-13H,14H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | WSNHWMDDWQUXDK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |