C33H38O8 — CID 11295976
(1R,3R,4R,5S,11S,13R,15S,17R,19Z,21S,22R,24S)-22-(hydroxymethyl)-4-(naphthalen-2-ylmethoxy)-2,6,12,16,23-pentaoxapentacyclo[13.11.0.03,13.05,11.017,24]hexacosa-8,19,25-trien-21-ol (PubChem CID 11295976) has the molecular formula C33H38O8 and a molecular weight of 562.66 g/mol. Its IUPAC name is (1R,3R,4R,5S,11S,13R,15S,17R,19Z,21S,22R,24S)-22-(hydroxymethyl)-4-(naphthalen-2-ylmethoxy)-2,6,12,16,23-pentaoxapentacyclo[13.11.0.03,13.05,11.017,24]hexacosa-8,19,25-trien-21-ol.
| Compound Name | (1R,3R,4R,5S,11S,13R,15S,17R,19Z,21S,22R,24S)-22-(hydroxymethyl)-4-(naphthalen-2-ylmethoxy)-2,6,12,16,23-pentaoxapentacyclo[13.11.0.03,13.05,11.017,24]hexacosa-8,19,25-trien-21-ol |
|---|---|
| PubChem CID | 11295976 |
| Molecular Formula | C33H38O8 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (1R,3R,4R,5S,11S,13R,15S,17R,19Z,21S,22R,24S)-22-(hydroxymethyl)-4-(naphthalen-2-ylmethoxy)-2,6,12,16,23-pentaoxapentacyclo[13.11.0.03,13.05,11.017,24]hexacosa-8,19,25-trien-21-ol |
| SMILES | OC[C@H]1O[C@H]2C=C[C@H]3O[C@H]4[C@H](OCc5ccc6ccccc6c5)[C@H]5OCC=CC[C@@H]5O[C@@H]4C[C@@H]3O[C@@H]2C/C=C\[C@@H]1O |
| InChI | InChI=1S/C33H38O8/c34-18-30-23(35)8-5-10-24-25(39-30)13-14-26-28(38-24)17-29-32(41-26)33(31-27(40-29)9-3-4-15-36-31)37-19-20-11-12-21-6-1-2-7-22(21)16-20/h1-8,11-14,16,23-35H,9-10,15,17-19H2/b8-5-/t23-,24+,25-,26+,27-,28-,29+,30+,31-,32+,33+/m0/s1 |
| InChIKey | LFFHOHWKJUPKEC-RUXCXDPRSA-N |
| XLogP | 3.39 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|